| Product Name | 4-Pyridoxic acid |
|---|---|
| CAS | 82-82-6 |
| Formula | C8H9NO4 |
| MW | 183.16 |
| Appearance | Pale Beige to Light Brown Solid |
| MDL | MFCD00006334 |
| Melting point | 258-261 °C (dec.) (lit.) |
| Boiling point | 584.5±50.0 °C(Predicted) |
| Storage condition | -20°C |
Product Center
MF:
C8H9NO4
MW:
183.16
Characters:Pale Beige to Light Brown Solid
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB124762 | yunbang | 25mg | 98% | $64.17 | Visible after login | Inquiry | ||
| YB124762 | yunbang | 100mg | 98% | $106.67 | Visible after login | Inquiry | ||
| YB124762 | yunbang | 100mg | 97% | $124.17 | Visible after login | In stock | ||
| YB124762 | yunbang | 250mg | 97% | $185.00 | Visible after login | In stock | ||
| YB124762 | yunbang | 1g | 97% | $463.33 | Visible after login | In stock |
| Product Name | 4-Pyridoxic acid |
|---|---|
| CAS | 82-82-6 |
| Formula | C8H9NO4 |
| MW | 183.16 |
| Appearance | Pale Beige to Light Brown Solid |
| MDL | MFCD00006334 |
| Melting point | 258-261 °C (dec.) (lit.) |
| Boiling point | 584.5±50.0 °C(Predicted) |
| Storage condition | -20°C |
| CAS | 82-82-6 |
|---|---|
| Formula | C8H9NO4 |
| MW | 183.16 |
| Appearance | Pale Beige to Light Brown Solid |
| MDL | MFCD00006334 |
| Melting point | 258-261 °C (dec.) (lit.) |
| Boiling point | 584.5±50.0 °C(Predicted) |
| Storage | -20°C |
| Smiles | C1(C(O)=C(C(=O)O)C(CO)=CN=1)C |
| InchiKey | HXACOUQIXZGNBF-UHFFFAOYSA-N |