| Product Name | Inetermediate of galanthamine 2 |
|---|---|
| CAS | 122584-17-2 |
| Formula | C17H19NO4 |
| MW | 301.34 |
| MDL | MFCD09752653 |
| Melting point | 148-1490C |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB63376 | yunbang | 500mg | NULL | $1216.67 | Visible after login | Inquiry | ||
| YB63376 | yunbang | 1g | NULL | $2033.33 | Visible after login | Inquiry |
| Product Name | Inetermediate of galanthamine 2 |
|---|---|
| CAS | 122584-17-2 |
| Formula | C17H19NO4 |
| MW | 301.34 |
| MDL | MFCD09752653 |
| Melting point | 148-1490C |
| CAS | 122584-17-2 |
|---|---|
| Formula | C17H19NO4 |
| MW | 301.34 |
| MDL | MFCD09752653 |
| Melting point | 148-1490C |
| Smiles | O=CN(CCc1ccc(O)cc1)Cc1cc(O)c(OC)cc1 |
| InchiKey | WWYFJMVJSXIUEE-UHFFFAOYSA-N |