| Product Name | 1,2-O-isopropylidene-alpha-D-allofuranose |
|---|---|
| CAS | 4495-04-9 |
| Formula | C9 H16 O6 |
| MW | 220.22 |
| MDL | MFCD07367509 |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | 1,2-O-isopropylidene-alpha-D-allofuranose |
|---|---|
| CAS | 4495-04-9 |
| Formula | C9 H16 O6 |
| MW | 220.22 |
| MDL | MFCD07367509 |
| CAS | 4495-04-9 |
|---|---|
| Formula | C9 H16 O6 |
| MW | 220.22 |
| MDL | MFCD07367509 |
| 特性 | * |
| Smiles | C12(C(O)C(C(O)CO)([H])OC1OC(C)(C)O2)[H] |
| InchiKey | BGGCXQKYCBBHAH-UHFFFAOYSA-N |