| Product Name | beta-D-Allofuranose |
|---|---|
| CAS | 36468-80-1 |
| Formula | C6 H12 O6 |
| MW | 180.16 |
| Boiling point | 476.9±45.0 °C(lit.) |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | beta-D-Allofuranose |
|---|---|
| CAS | 36468-80-1 |
| Formula | C6 H12 O6 |
| MW | 180.16 |
| Boiling point | 476.9±45.0 °C(lit.) |
| CAS | 36468-80-1 |
|---|---|
| Formula | C6 H12 O6 |
| MW | 180.16 |
| Boiling point | 476.9±45.0 °C(lit.) |
| 特性 | * |
| Smiles | C(O)[C@@H](O)[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O |
| InchiKey | AVVWPBAENSWJCB-AIECOIEWSA-N |